About 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole
2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole (PubChem CID 12979399) has the molecular formula C22H16ClF2N
and a molecular weight of 367.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole |
| PubChem CID | 12979399 |
| Molecular Formula | C22H16ClF2N |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole |
| SMILES | Fc1cccc(F)c1C1=NC(c2ccc(Cl)cc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C22H16ClF2N/c23-16-11-9-15(10-12-16)22-17(14-5-2-1-3-6-14)13-20(26-22)21-18(24)7-4-8-19(21)25/h1-12,17,22H,13H2 |
| InChIKey | MWFZPWXEQMULKV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole?
The IUPAC name of 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole (CID 12979399) is 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole is Fc1cccc(F)c1C1=NC(c2ccc(Cl)cc2)C(c2ccccc2)C1.
What is the InChIKey of 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole?
The InChIKey is MWFZPWXEQMULKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClF2N/c23-16-11-9-15(10-12-16)22-17(14-5-2-1-3-6-14)13-20(26-22)21-18(24)7-4-8-19(21)25/h1-12,17,22H,13H2.
What are the key properties of 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole?
2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole has a molecular weight of 367.83 g/mol, XLogP of 6.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-5-(2,6-difluorophenyl)-3-phenyl-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 12979399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).