About oxolane;triethylborane
oxolane;triethylborane (PubChem CID 12979806) has the molecular formula C10H23BO
and a molecular weight of 170.10 g/mol. Its IUPAC name is oxolane;triethylborane.
Molecular Properties
| Compound Name | oxolane;triethylborane |
| PubChem CID | 12979806 |
| Molecular Formula | C10H23BO |
| Molecular Weight | 170.10 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | oxolane;triethylborane |
| SMILES | C1CCOC1.CCB(CC)CC |
| InChI | InChI=1S/C6H15B.C4H8O/c1-4-7(5-2)6-3;1-2-4-5-3-1/h4-6H2,1-3H3;1-4H2 |
| InChIKey | PNUHMQOYKCSNPU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.10 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze oxolane;triethylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane;triethylborane?
The IUPAC name of oxolane;triethylborane (CID 12979806) is oxolane;triethylborane.
What is the SMILES notation for oxolane;triethylborane?
The canonical SMILES for oxolane;triethylborane is C1CCOC1.CCB(CC)CC.
What is the InChIKey of oxolane;triethylborane?
The InChIKey is PNUHMQOYKCSNPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15B.C4H8O/c1-4-7(5-2)6-3;1-2-4-5-3-1/h4-6H2,1-3H3;1-4H2.
What are the key properties of oxolane;triethylborane?
oxolane;triethylborane has a molecular weight of 170.10 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane;triethylborane is sourced from PubChem (CID 12979806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).