C21H15Cl3N2 — CID 12980493
(4R,5S)-2,4,5-tris(4-chlorophenyl)-4,5-dihydro-1H-imidazole (PubChem CID 12980493) has the molecular formula C21H15Cl3N2 and a molecular weight of 401.72 g/mol. Its IUPAC name is (4R,5S)-2,4,5-tris(4-chlorophenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5S)-2,4,5-tris(4-chlorophenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 12980493 |
| Molecular Formula | C21H15Cl3N2 |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | (4R,5S)-2,4,5-tris(4-chlorophenyl)-4,5-dihydro-1H-imidazole |
| SMILES | Clc1ccc(C2=N[C@H](c3ccc(Cl)cc3)[C@H](c3ccc(Cl)cc3)N2)cc1 |
| InChI | InChI=1S/C21H15Cl3N2/c22-16-7-1-13(2-8-16)19-20(14-3-9-17(23)10-4-14)26-21(25-19)15-5-11-18(24)12-6-15/h1-12,19-20H,(H,25,26)/t19-,20+ |
| InChIKey | LRLGPICGNUWXAN-BGYRXZFFSA-N |
| XLogP | 6.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |