C10H11F3N2OS — CID 12981653
(Z)-3-(2,2-dimethylhydrazinyl)-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one (PubChem CID 12981653) has the molecular formula C10H11F3N2OS and a molecular weight of 264.27 g/mol. Its IUPAC name is (Z)-3-(2,2-dimethylhydrazinyl)-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one.
| Compound Name | (Z)-3-(2,2-dimethylhydrazinyl)-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one |
|---|---|
| PubChem CID | 12981653 |
| Molecular Formula | C10H11F3N2OS |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (Z)-3-(2,2-dimethylhydrazinyl)-4,4,4-trifluoro-1-thiophen-2-ylbut-2-en-1-one |
| SMILES | CN(C)N/C(=C\C(=O)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2OS/c1-15(2)14-9(10(11,12)13)6-7(16)8-4-3-5-17-8/h3-6,14H,1-2H3/b9-6- |
| InChIKey | WYZGHNQVLKTNPL-TWGQIWQCSA-N |
| XLogP | 2.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|