C22H40Si2 — CID 12981874
1,1,3,3-tetramethyl-2,4-bis(2,4,4-trimethylpent-1-enylidene)-1,3-disiletane (PubChem CID 12981874) has the molecular formula C22H40Si2 and a molecular weight of 360.73 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2,4-bis(2,4,4-trimethylpent-1-enylidene)-1,3-disiletane.
| Compound Name | 1,1,3,3-tetramethyl-2,4-bis(2,4,4-trimethylpent-1-enylidene)-1,3-disiletane |
|---|---|
| PubChem CID | 12981874 |
| Molecular Formula | C22H40Si2 |
| Molecular Weight | 360.73 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 1,1,3,3-tetramethyl-2,4-bis(2,4,4-trimethylpent-1-enylidene)-1,3-disiletane |
| SMILES | CC(=C=C1[Si](C)(C)C(=C=C(C)CC(C)(C)C)[Si]1(C)C)CC(C)(C)C |
| InChI | InChI=1S/C22H40Si2/c1-17(15-21(3,4)5)13-19-23(9,10)20(24(19,11)12)14-18(2)16-22(6,7)8/h15-16H2,1-12H3 |
| InChIKey | NNTXMAAOXAYFTO-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.73 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|