C33H60Si3 — CID 12981875
1,1,3,3,5,5-hexamethyl-2,4,6-tris(2,4,4-trimethylpent-1-enylidene)-1,3,5-trisilinane (PubChem CID 12981875) has the molecular formula C33H60Si3 and a molecular weight of 541.10 g/mol. Its IUPAC name is 1,1,3,3,5,5-hexamethyl-2,4,6-tris(2,4,4-trimethylpent-1-enylidene)-1,3,5-trisilinane.
| Compound Name | 1,1,3,3,5,5-hexamethyl-2,4,6-tris(2,4,4-trimethylpent-1-enylidene)-1,3,5-trisilinane |
|---|---|
| PubChem CID | 12981875 |
| Molecular Formula | C33H60Si3 |
| Molecular Weight | 541.10 g/mol |
| Exact Mass | 540.40 |
| IUPAC Name | 1,1,3,3,5,5-hexamethyl-2,4,6-tris(2,4,4-trimethylpent-1-enylidene)-1,3,5-trisilinane |
| SMILES | CC(=C=C1[Si](C)(C)C(=C=C(C)CC(C)(C)C)[Si](C)(C)C(=C=C(C)CC(C)(C)C)[Si]1(C)C)CC(C)(C)C |
| InChI | InChI=1S/C33H60Si3/c1-25(22-31(4,5)6)19-28-34(13,14)29(20-26(2)23-32(7,8)9)36(17,18)30(35(28,15)16)21-27(3)24-33(10,11)12/h22-24H2,1-18H3 |
| InChIKey | OILMMJXEKJDJEB-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.10 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|