About ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate
ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate (PubChem CID 12981947) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate |
| PubChem CID | 12981947 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1oc(C(C)N)nc1C |
| InChI | InChI=1S/C9H14N2O3/c1-4-13-9(12)7-6(3)11-8(14-7)5(2)10/h5H,4,10H2,1-3H3 |
| InChIKey | FPRROMGKAODOOB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate?
The IUPAC name of ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate (CID 12981947) is ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate?
The canonical SMILES for ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate is CCOC(=O)c1oc(C(C)N)nc1C.
What is the InChIKey of ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate?
The InChIKey is FPRROMGKAODOOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-4-13-9(12)7-6(3)11-8(14-7)5(2)10/h5H,4,10H2,1-3H3.
What are the key properties of ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate?
ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate has a molecular weight of 198.22 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1-aminoethyl)-4-methyl-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 12981947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).