C50H63Br2NO2 — CID 12982435
[2,7-dibromo-9-(2-ethylhexyl)-6-(4-octylbenzoyl)carbazol-3-yl]-(4-octylphenyl)methanone (PubChem CID 12982435) has the molecular formula C50H63Br2NO2 and a molecular weight of 869.87 g/mol. Its IUPAC name is [2,7-dibromo-9-(2-ethylhexyl)-6-(4-octylbenzoyl)carbazol-3-yl]-(4-octylphenyl)methanone.
| Compound Name | [2,7-dibromo-9-(2-ethylhexyl)-6-(4-octylbenzoyl)carbazol-3-yl]-(4-octylphenyl)methanone |
|---|---|
| PubChem CID | 12982435 |
| Molecular Formula | C50H63Br2NO2 |
| Molecular Weight | 869.87 g/mol |
| Exact Mass | 867.32 |
| IUPAC Name | [2,7-dibromo-9-(2-ethylhexyl)-6-(4-octylbenzoyl)carbazol-3-yl]-(4-octylphenyl)methanone |
| SMILES | CCCCCCCCc1ccc(C(=O)c2cc3c4cc(C(=O)c5ccc(CCCCCCCC)cc5)c(Br)cc4n(CC(CC)CCCC)c3cc2Br)cc1 |
| InChI | InChI=1S/C50H63Br2NO2/c1-5-9-12-14-16-18-21-37-23-27-39(28-24-37)49(54)43-31-41-42-32-44(50(55)40-29-25-38(26-30-40)22-19-17-15-13-10-6-2)46(52)34-48(42)53(47(41)33-45(43)51)35-36(8-4)20-11-7-3/h23-34,36H,5-22,35H2,1-4H3 |
| InChIKey | YUCJHLPNKHPKPT-UHFFFAOYSA-N |
| XLogP | 15.80 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.87 |
| LogP ≤ 5 | 15.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|