About 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane
12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane (PubChem CID 12982838) has the molecular formula C10H16O2S2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane.
Molecular Properties
| Compound Name | 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane |
| PubChem CID | 12982838 |
| Molecular Formula | C10H16O2S2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane |
| SMILES | S=S1OC2(CCCC2)C2(CCCC2)O1 |
| InChI | InChI=1S/C10H16O2S2/c13-14-11-9(5-1-2-6-9)10(12-14)7-3-4-8-10/h1-8H2 |
| InChIKey | JNHFYGXDJCMSJN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane?
The IUPAC name of 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane (CID 12982838) is 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane.
What is the SMILES notation for 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane?
The canonical SMILES for 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane is S=S1OC2(CCCC2)C2(CCCC2)O1.
What is the InChIKey of 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane?
The InChIKey is JNHFYGXDJCMSJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S2/c13-14-11-9(5-1-2-6-9)10(12-14)7-3-4-8-10/h1-8H2.
What are the key properties of 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane?
12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane has a molecular weight of 232.37 g/mol, XLogP of 2.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 12-sulfanylidene-11,13-dioxa-12lambda4-thiadispiro[4.0.46.35]tridecane is sourced from PubChem (CID 12982838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).