C22H12O9S — CID 12983386
9,10-dioxo-6-(4-sulfophenyl)anthracene-2,3-dicarboxylic acid (PubChem CID 12983386) has the molecular formula C22H12O9S and a molecular weight of 452.40 g/mol. Its IUPAC name is 9,10-dioxo-6-(4-sulfophenyl)anthracene-2,3-dicarboxylic acid.
| Compound Name | 9,10-dioxo-6-(4-sulfophenyl)anthracene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 12983386 |
| Molecular Formula | C22H12O9S |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 9,10-dioxo-6-(4-sulfophenyl)anthracene-2,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc2c(cc1C(=O)O)C(=O)c1cc(-c3ccc(S(=O)(=O)O)cc3)ccc1C2=O |
| InChI | InChI=1S/C22H12O9S/c23-19-13-6-3-11(10-1-4-12(5-2-10)32(29,30)31)7-14(13)20(24)16-9-18(22(27)28)17(21(25)26)8-15(16)19/h1-9H,(H,25,26)(H,27,28)(H,29,30,31) |
| InChIKey | FOXMZJWKVSBVPF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|