About 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane
1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane (PubChem CID 12983468) has the molecular formula C34H40N2O2P2
and a molecular weight of 570.65 g/mol. Its IUPAC name is 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane.
Molecular Properties
| Compound Name | 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane |
| PubChem CID | 12983468 |
| Molecular Formula | C34H40N2O2P2 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane |
| SMILES | O=P(CCN1CCCN(CCP(=O)(c2ccccc2)c2ccccc2)CCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H40N2O2P2/c37-39(31-15-5-1-6-16-31,32-17-7-2-8-18-32)29-27-35-23-13-25-36(26-14-24-35)28-30-40(38,33-19-9-3-10-20-33)34-21-11-4-12-22-34/h1-12,15-22H,13-14,23-30H2 |
| InChIKey | HYPMGIQDLKGILD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane?
The IUPAC name of 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane (CID 12983468) is 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane.
What is the SMILES notation for 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane?
The canonical SMILES for 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane is O=P(CCN1CCCN(CCP(=O)(c2ccccc2)c2ccccc2)CCC1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane?
The InChIKey is HYPMGIQDLKGILD-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H40N2O2P2/c37-39(31-15-5-1-6-16-31,32-17-7-2-8-18-32)29-27-35-23-13-25-36(26-14-24-35)28-30-40(38,33-19-9-3-10-20-33)34-21-11-4-12-22-34/h1-12,15-22H,13-14,23-30H2.
What are the key properties of 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane?
1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane has a molecular weight of 570.65 g/mol, XLogP of 5.41, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-bis(2-diphenylphosphorylethyl)-1,5-diazocane is sourced from PubChem (CID 12983468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).