C6H14O2 — CID 12985040
1,1,1,4,4,4-hexadeuterio-2,3-bis(trideuteriomethyl)butane-2,3-diol (PubChem CID 12985040) has the molecular formula C6H14O2 and a molecular weight of 130.25 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexadeuterio-2,3-bis(trideuteriomethyl)butane-2,3-diol.
| Compound Name | 1,1,1,4,4,4-hexadeuterio-2,3-bis(trideuteriomethyl)butane-2,3-diol |
|---|---|
| PubChem CID | 12985040 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 130.25 g/mol |
| Exact Mass | 130.17 |
| IUPAC Name | 1,1,1,4,4,4-hexadeuterio-2,3-bis(trideuteriomethyl)butane-2,3-diol |
| SMILES | [2H]C([2H])([2H])C(O)(C([2H])([2H])[2H])C(O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C6H14O2/c1-5(2,7)6(3,4)8/h7-8H,1-4H3/i1D3,2D3,3D3,4D3 |
| InChIKey | IVDFJHOHABJVEH-MGKWXGLJSA-N |
| XLogP | 0.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |