About p-(1-Dimethylamino ethylimino)aniline
p-(1-Dimethylamino ethylimino)aniline (PubChem CID 129852262) has the molecular formula C10H17N3
and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-[1-(dimethylamino)ethylimino]cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | p-(1-Dimethylamino ethylimino)aniline |
| PubChem CID | 129852262 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 4-[1-(dimethylamino)ethylimino]cyclohexa-1,5-dien-1-amine |
| SMILES | CC(N=C1CC=C(C=C1)N)N(C)C |
| InChI | InChI=1S/C10H17N3/c1-8(13(2)3)12-10-6-4-9(11)5-7-10/h4-6,8H,7,11H2,1-3H3 |
| InChIKey | ARRXHBGKKXCKPF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 41.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | 261 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze p-(1-Dimethylamino ethylimino)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of p-(1-Dimethylamino ethylimino)aniline?
The IUPAC name of p-(1-Dimethylamino ethylimino)aniline (CID 129852262) is 4-[1-(dimethylamino)ethylimino]cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for p-(1-Dimethylamino ethylimino)aniline?
The canonical SMILES for p-(1-Dimethylamino ethylimino)aniline is CC(N=C1CC=C(C=C1)N)N(C)C.
What is the InChIKey of p-(1-Dimethylamino ethylimino)aniline?
The InChIKey is ARRXHBGKKXCKPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-8(13(2)3)12-10-6-4-9(11)5-7-10/h4-6,8H,7,11H2,1-3H3.
What are the key properties of p-(1-Dimethylamino ethylimino)aniline?
p-(1-Dimethylamino ethylimino)aniline has a molecular weight of 179.26 g/mol, XLogP of 0.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for p-(1-Dimethylamino ethylimino)aniline is sourced from PubChem (CID 129852262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).