C17H38N6 — CID 12985241
1-[5-(1,4,7-triazonan-1-yl)pentyl]-1,4,7-triazonane (PubChem CID 12985241) has the molecular formula C17H38N6 and a molecular weight of 326.53 g/mol. Its IUPAC name is 1-[5-(1,4,7-triazonan-1-yl)pentyl]-1,4,7-triazonane.
| Compound Name | 1-[5-(1,4,7-triazonan-1-yl)pentyl]-1,4,7-triazonane |
|---|---|
| PubChem CID | 12985241 |
| Molecular Formula | C17H38N6 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.32 |
| IUPAC Name | 1-[5-(1,4,7-triazonan-1-yl)pentyl]-1,4,7-triazonane |
| SMILES | C(CCN1CCNCCNCC1)CCN1CCNCCNCC1 |
| InChI | InChI=1S/C17H38N6/c1(2-12-22-14-8-18-4-5-19-9-15-22)3-13-23-16-10-20-6-7-21-11-17-23/h18-21H,1-17H2 |
| InChIKey | MABPFOVADXJBEY-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|