About 2,3-diaminopropan-1-ol;dihydrochloride
2,3-diaminopropan-1-ol;dihydrochloride (PubChem CID 12985260) has the molecular formula C3H12Cl2N2O
and a molecular weight of 163.05 g/mol. Its IUPAC name is 2,3-diaminopropan-1-ol;dihydrochloride.
Molecular Properties
| Compound Name | 2,3-diaminopropan-1-ol;dihydrochloride |
| PubChem CID | 12985260 |
| Molecular Formula | C3H12Cl2N2O |
| Molecular Weight | 163.05 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | 2,3-diaminopropan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.NCC(N)CO |
| InChI | InChI=1S/C3H10N2O.2ClH/c4-1-3(5)2-6;;/h3,6H,1-2,4-5H2;2*1H |
| InChIKey | IKBUWJHUBADHSZ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.05 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-diaminopropan-1-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diaminopropan-1-ol;dihydrochloride?
The IUPAC name of 2,3-diaminopropan-1-ol;dihydrochloride (CID 12985260) is 2,3-diaminopropan-1-ol;dihydrochloride.
What is the SMILES notation for 2,3-diaminopropan-1-ol;dihydrochloride?
The canonical SMILES for 2,3-diaminopropan-1-ol;dihydrochloride is Cl.Cl.NCC(N)CO.
What is the InChIKey of 2,3-diaminopropan-1-ol;dihydrochloride?
The InChIKey is IKBUWJHUBADHSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N2O.2ClH/c4-1-3(5)2-6;;/h3,6H,1-2,4-5H2;2*1H.
What are the key properties of 2,3-diaminopropan-1-ol;dihydrochloride?
2,3-diaminopropan-1-ol;dihydrochloride has a molecular weight of 163.05 g/mol, XLogP of -0.89, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diaminopropan-1-ol;dihydrochloride is sourced from PubChem (CID 12985260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).