C24H34O3 — CID 12985833
(8R,9S,13S,14S)-13-ethyl-5',5'-dimethylspiro[1,2,4,6,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-17-one (PubChem CID 12985833) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is (8R,9S,13S,14S)-13-ethyl-5',5'-dimethylspiro[1,2,4,6,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-17-one.
| Compound Name | (8R,9S,13S,14S)-13-ethyl-5',5'-dimethylspiro[1,2,4,6,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-17-one |
|---|---|
| PubChem CID | 12985833 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (8R,9S,13S,14S)-13-ethyl-5',5'-dimethylspiro[1,2,4,6,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-17-one |
| SMILES | CC[C@]12CC[C@@H]3C4=C(CC[C@H]3[C@@H]1C=CC2=O)CC1(CC4)OCC(C)(C)CO1 |
| InChI | InChI=1S/C24H34O3/c1-4-23-11-9-18-17-10-12-24(26-14-22(2,3)15-27-24)13-16(17)5-6-19(18)20(23)7-8-21(23)25/h7-8,18-20H,4-6,9-15H2,1-3H3/t18-,19-,20+,23+/m1/s1 |
| InChIKey | DWZTYQDLBHFCDS-UGTOYMOASA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|