C14H17N3O5 — CID 12985917
(6-formyl-5-methoxy-4-oxopyrrolo[2,1-f][1,2,4]triazin-3-yl)methyl 2,2-dimethylpropanoate (PubChem CID 12985917) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is (6-formyl-5-methoxy-4-oxopyrrolo[2,1-f][1,2,4]triazin-3-yl)methyl 2,2-dimethylpropanoate.
| Compound Name | (6-formyl-5-methoxy-4-oxopyrrolo[2,1-f][1,2,4]triazin-3-yl)methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 12985917 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (6-formyl-5-methoxy-4-oxopyrrolo[2,1-f][1,2,4]triazin-3-yl)methyl 2,2-dimethylpropanoate |
| SMILES | COc1c(C=O)cn2ncn(COC(=O)C(C)(C)C)c(=O)c12 |
| InChI | InChI=1S/C14H17N3O5/c1-14(2,3)13(20)22-8-16-7-15-17-5-9(6-18)11(21-4)10(17)12(16)19/h5-7H,8H2,1-4H3 |
| InChIKey | VHKIKXXKUSZSAH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 91.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|