About N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide
N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide (PubChem CID 1298622) has the molecular formula C19H21N3O2S
and a molecular weight of 355.46 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide |
| PubChem CID | 1298622 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-n2nc(C)c(NS(=O)(=O)c3ccccc3)c2C)cc1C |
| InChI | InChI=1S/C19H21N3O2S/c1-13-10-11-17(12-14(13)2)22-16(4)19(15(3)20-22)21-25(23,24)18-8-6-5-7-9-18/h5-12,21H,1-4H3 |
| InChIKey | CNAVWEHBSBPVKE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide?
The IUPAC name of N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide (CID 1298622) is N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide.
What is the SMILES notation for N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide?
The canonical SMILES for N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide is Cc1ccc(-n2nc(C)c(NS(=O)(=O)c3ccccc3)c2C)cc1C.
What is the InChIKey of N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide?
The InChIKey is CNAVWEHBSBPVKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O2S/c1-13-10-11-17(12-14(13)2)22-16(4)19(15(3)20-22)21-25(23,24)18-8-6-5-7-9-18/h5-12,21H,1-4H3.
What are the key properties of N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide?
N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide has a molecular weight of 355.46 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]benzenesulfonamide is sourced from PubChem (CID 1298622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).