About (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol
(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol (PubChem CID 12986386) has the molecular formula C14H24O3
and a molecular weight of 240.34 g/mol. Its IUPAC name is (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol.
Molecular Properties
| Compound Name | (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol |
| PubChem CID | 12986386 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol |
| SMILES | C=C(C)C(O)/C=C/CCCOC1CCCCO1 |
| InChI | InChI=1S/C14H24O3/c1-12(2)13(15)8-4-3-6-10-16-14-9-5-7-11-17-14/h4,8,13-15H,1,3,5-7,9-11H2,2H3/b8-4+ |
| InChIKey | SDSFETZMERKCFL-XBXARRHUSA-N |
| XLogP | 2.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol?
The IUPAC name of (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol (CID 12986386) is (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol.
What is the SMILES notation for (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol?
The canonical SMILES for (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol is C=C(C)C(O)/C=C/CCCOC1CCCCO1.
What is the InChIKey of (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol?
The InChIKey is SDSFETZMERKCFL-XBXARRHUSA-N. The full InChI is InChI=1S/C14H24O3/c1-12(2)13(15)8-4-3-6-10-16-14-9-5-7-11-17-14/h4,8,13-15H,1,3,5-7,9-11H2,2H3/b8-4+.
What are the key properties of (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol?
(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol has a molecular weight of 240.34 g/mol, XLogP of 2.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-ol is sourced from PubChem (CID 12986386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).