About [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate
[(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate (PubChem CID 12986387) has the molecular formula C17H28O4
and a molecular weight of 296.41 g/mol. Its IUPAC name is [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate.
Molecular Properties
| Compound Name | [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate |
| PubChem CID | 12986387 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate |
| SMILES | C=C(C)C(/C=C/CCCOC1CCCCO1)OC(=O)CC |
| InChI | InChI=1S/C17H28O4/c1-4-16(18)21-15(14(2)3)10-6-5-8-12-19-17-11-7-9-13-20-17/h6,10,15,17H,2,4-5,7-9,11-13H2,1,3H3/b10-6+ |
| InChIKey | IZQCGYQXCGYUBE-UXBLZVDNSA-N |
| XLogP | 3.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate?
The IUPAC name of [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate (CID 12986387) is [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate.
What is the SMILES notation for [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate?
The canonical SMILES for [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate is C=C(C)C(/C=C/CCCOC1CCCCO1)OC(=O)CC.
What is the InChIKey of [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate?
The InChIKey is IZQCGYQXCGYUBE-UXBLZVDNSA-N. The full InChI is InChI=1S/C17H28O4/c1-4-16(18)21-15(14(2)3)10-6-5-8-12-19-17-11-7-9-13-20-17/h6,10,15,17H,2,4-5,7-9,11-13H2,1,3H3/b10-6+.
What are the key properties of [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate?
[(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate has a molecular weight of 296.41 g/mol, XLogP of 3.76, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4E)-2-methyl-8-(oxan-2-yloxy)octa-1,4-dien-3-yl] propanoate is sourced from PubChem (CID 12986387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).