About 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline
1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline (PubChem CID 12986945) has the molecular formula C24H14N4O4
and a molecular weight of 422.40 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline.
Molecular Properties
| Compound Name | 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline |
| PubChem CID | 12986945 |
| Molecular Formula | C24H14N4O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(-c3cccc([N+](=O)[O-])c3)c3c(ccc4ncccc43)n2)cc1 |
| InChI | InChI=1S/C24H14N4O4/c29-27(30)17-8-6-15(7-9-17)23-14-20(16-3-1-4-18(13-16)28(31)32)24-19-5-2-12-25-21(19)10-11-22(24)26-23/h1-14H |
| InChIKey | RPHRLJLPGHVSDG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline?
The IUPAC name of 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline (CID 12986945) is 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline.
What is the SMILES notation for 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline?
The canonical SMILES for 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline is O=[N+]([O-])c1ccc(-c2cc(-c3cccc([N+](=O)[O-])c3)c3c(ccc4ncccc43)n2)cc1.
What is the InChIKey of 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline?
The InChIKey is RPHRLJLPGHVSDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14N4O4/c29-27(30)17-8-6-15(7-9-17)23-14-20(16-3-1-4-18(13-16)28(31)32)24-19-5-2-12-25-21(19)10-11-22(24)26-23/h1-14H.
What are the key properties of 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline?
1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline has a molecular weight of 422.40 g/mol, XLogP of 5.93, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-nitrophenyl)-3-(4-nitrophenyl)-4,7-phenanthroline is sourced from PubChem (CID 12986945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).