C18H34O5Si — CID 12987025
[(2S,3S,4aS,5R,8aR)-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 12987025) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is [(2S,3S,4aS,5R,8aR)-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S,4aS,5R,8aR)-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 12987025 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | [(2S,3S,4aS,5R,8aR)-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@]1(C)O[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)C=CC[C@H]2O[C@]1(C)OC |
| InChI | InChI=1S/C18H34O5Si/c1-16(2,3)24(8,9)23-14-12-10-11-13-15(14)22-18(5,20-7)17(4,19-6)21-13/h10,12-15H,11H2,1-9H3/t13-,14-,15+,17+,18+/m1/s1 |
| InChIKey | DVPIKPGDPPIDGY-YONAWACDSA-N |
| XLogP | 3.85 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|