About (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol
(1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol (PubChem CID 12987108) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol.
Molecular Properties
| Compound Name | (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol |
| PubChem CID | 12987108 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol |
| SMILES | CC(C)c1cccc2c1[C@H](N)[C@H](O)C2 |
| InChI | InChI=1S/C12H17NO/c1-7(2)9-5-3-4-8-6-10(14)12(13)11(8)9/h3-5,7,10,12,14H,6,13H2,1-2H3/t10-,12-/m1/s1 |
| InChIKey | LFJCMAIRHIWPTC-ZYHUDNBSSA-N |
| XLogP | 1.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol?
The IUPAC name of (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol (CID 12987108) is (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol.
What is the SMILES notation for (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol?
The canonical SMILES for (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol is CC(C)c1cccc2c1[C@H](N)[C@H](O)C2.
What is the InChIKey of (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol?
The InChIKey is LFJCMAIRHIWPTC-ZYHUDNBSSA-N. The full InChI is InChI=1S/C12H17NO/c1-7(2)9-5-3-4-8-6-10(14)12(13)11(8)9/h3-5,7,10,12,14H,6,13H2,1-2H3/t10-,12-/m1/s1.
What are the key properties of (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol?
(1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol has a molecular weight of 191.27 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-1-amino-7-propan-2-yl-2,3-dihydro-1H-inden-2-ol is sourced from PubChem (CID 12987108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).