C17H17NO4S — CID 12987305
(3S,3aR,6aR)-3-(3-methylphenyl)-2-phenyl-3,3a,6,6a-tetrahydrooxathiolo[3,4-d][1,2]oxazole 4,4-dioxide (PubChem CID 12987305) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is (3S,3aR,6aR)-3-(3-methylphenyl)-2-phenyl-3,3a,6,6a-tetrahydrooxathiolo[3,4-d][1,2]oxazole 4,4-dioxide.
| Compound Name | (3S,3aR,6aR)-3-(3-methylphenyl)-2-phenyl-3,3a,6,6a-tetrahydrooxathiolo[3,4-d][1,2]oxazole 4,4-dioxide |
|---|---|
| PubChem CID | 12987305 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | (3S,3aR,6aR)-3-(3-methylphenyl)-2-phenyl-3,3a,6,6a-tetrahydrooxathiolo[3,4-d][1,2]oxazole 4,4-dioxide |
| SMILES | Cc1cccc([C@H]2[C@@H]3[C@@H](COS3(=O)=O)ON2c2ccccc2)c1 |
| InChI | InChI=1S/C17H17NO4S/c1-12-6-5-7-13(10-12)16-17-15(11-21-23(17,19)20)22-18(16)14-8-3-2-4-9-14/h2-10,15-17H,11H2,1H3/t15-,16+,17+/m1/s1 |
| InChIKey | ZLGXQWKOCXKHGN-IKGGRYGDSA-N |
| XLogP | 2.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|