About 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide
5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide (PubChem CID 12987477) has the molecular formula C12H20ClNO3S2
and a molecular weight of 325.88 g/mol. Its IUPAC name is 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide |
| PubChem CID | 12987477 |
| Molecular Formula | C12H20ClNO3S2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide |
| SMILES | CC(C)C[C@@H](C)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H20ClNO3S2/c1-8(2)6-9(3)10(7-15)14-19(16,17)12-5-4-11(13)18-12/h4-5,8-10,14-15H,6-7H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | IDPXDQNYPHCBAF-NXEZZACHSA-N |
| XLogP | 2.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide?
The IUPAC name of 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide (CID 12987477) is 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide?
The canonical SMILES for 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide is CC(C)C[C@@H](C)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)s1.
What is the InChIKey of 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide?
The InChIKey is IDPXDQNYPHCBAF-NXEZZACHSA-N. The full InChI is InChI=1S/C12H20ClNO3S2/c1-8(2)6-9(3)10(7-15)14-19(16,17)12-5-4-11(13)18-12/h4-5,8-10,14-15H,6-7H2,1-3H3/t9-,10-/m1/s1.
What are the key properties of 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide?
5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide has a molecular weight of 325.88 g/mol, XLogP of 2.72, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(2S,3R)-1-hydroxy-3,5-dimethylhexan-2-yl]thiophene-2-sulfonamide is sourced from PubChem (CID 12987477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).