C9H12F6N2O — CID 12988238
4-[2-(dimethylamino)ethylimino]-1,1,1,5,5,5-hexafluoropentan-2-one (PubChem CID 12988238) has the molecular formula C9H12F6N2O and a molecular weight of 278.20 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethylimino]-1,1,1,5,5,5-hexafluoropentan-2-one.
| Compound Name | 4-[2-(dimethylamino)ethylimino]-1,1,1,5,5,5-hexafluoropentan-2-one |
|---|---|
| PubChem CID | 12988238 |
| Molecular Formula | C9H12F6N2O |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-[2-(dimethylamino)ethylimino]-1,1,1,5,5,5-hexafluoropentan-2-one |
| SMILES | CN(C)CC/N=C(\CC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F6N2O/c1-17(2)4-3-16-6(8(10,11)12)5-7(18)9(13,14)15/h3-5H2,1-2H3/b16-6+ |
| InChIKey | UWNHYTNBXUUZDG-OMCISZLKSA-N |
| XLogP | 2.07 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|