C21H40O3Si — CID 12988293
methyl (9Z,11E,13S)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-9,11-dienoate (PubChem CID 12988293) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is methyl (9Z,11E,13S)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-9,11-dienoate.
| Compound Name | methyl (9Z,11E,13S)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-9,11-dienoate |
|---|---|
| PubChem CID | 12988293 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | methyl (9Z,11E,13S)-13-[tert-butyl(dimethyl)silyl]oxytetradeca-9,11-dienoate |
| SMILES | COC(=O)CCCCCCC/C=C\C=C\[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O3Si/c1-19(24-25(6,7)21(2,3)4)17-15-13-11-9-8-10-12-14-16-18-20(22)23-5/h11,13,15,17,19H,8-10,12,14,16,18H2,1-7H3/b13-11-,17-15+/t19-/m0/s1 |
| InChIKey | IOGUBSIWZKCWGO-QKTTZCKWSA-N |
| XLogP | 6.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|