C4H11N3 — CID 12988583
pyrrolidine-3,4-diamine (PubChem CID 12988583) has the molecular formula C4H11N3 and a molecular weight of 101.15 g/mol. Its IUPAC name is pyrrolidine-3,4-diamine.
| Compound Name | pyrrolidine-3,4-diamine |
|---|---|
| PubChem CID | 12988583 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | pyrrolidine-3,4-diamine |
| SMILES | NC1CNCC1N |
| InChI | InChI=1S/C4H11N3/c5-3-1-7-2-4(3)6/h3-4,7H,1-2,5-6H2 |
| InChIKey | WCOQAGPRGRKKLM-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |