C23H14Cl4N2O4 — CID 12988612
2-[[2-chloro-4-[2-oxo-2-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]ethyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 12988612) has the molecular formula C23H14Cl4N2O4 and a molecular weight of 524.19 g/mol. Its IUPAC name is 2-[[2-chloro-4-[2-oxo-2-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]ethyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-chloro-4-[2-oxo-2-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]ethyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 12988612 |
| Molecular Formula | C23H14Cl4N2O4 |
| Molecular Weight | 524.19 g/mol |
| Exact Mass | 521.97 |
| IUPAC Name | 2-[[2-chloro-4-[2-oxo-2-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]ethyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C(Cc1ccc(CN2C(=O)c3ccccc3C2=O)c(Cl)c1)c1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C23H14Cl4N2O4/c24-17-7-12(8-19(30)14-9-18(28-10-14)20(31)23(25,26)27)5-6-13(17)11-29-21(32)15-3-1-2-4-16(15)22(29)33/h1-7,9-10,28H,8,11H2 |
| InChIKey | VWUPFRUFYBGIAP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.19 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|