About 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one
4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one (PubChem CID 12988792) has the molecular formula C14H10N6O
and a molecular weight of 278.28 g/mol. Its IUPAC name is 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one.
Molecular Properties
| Compound Name | 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one |
| PubChem CID | 12988792 |
| Molecular Formula | C14H10N6O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one |
| SMILES | Nc1c(-c2nc3ncccc3[nH]2)c(=O)[nH]c2cnccc12 |
| InChI | InChI=1S/C14H10N6O/c15-11-7-3-5-16-6-9(7)19-14(21)10(11)13-18-8-2-1-4-17-12(8)20-13/h1-6H,(H3,15,19,21)(H,17,18,20) |
| InChIKey | SNYMIRFSGCNEHH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one?
The IUPAC name of 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one (CID 12988792) is 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one.
What is the SMILES notation for 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one?
The canonical SMILES for 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one is Nc1c(-c2nc3ncccc3[nH]2)c(=O)[nH]c2cnccc12.
What is the InChIKey of 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one?
The InChIKey is SNYMIRFSGCNEHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N6O/c15-11-7-3-5-16-6-9(7)19-14(21)10(11)13-18-8-2-1-4-17-12(8)20-13/h1-6H,(H3,15,19,21)(H,17,18,20).
What are the key properties of 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one?
4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one has a molecular weight of 278.28 g/mol, XLogP of 1.44, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(1H-imidazo[4,5-b]pyridin-2-yl)-1H-1,7-naphthyridin-2-one is sourced from PubChem (CID 12988792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).