C10H15NO2 — CID 12988804
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl] acetate (PubChem CID 12988804) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl] acetate.
| Compound Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl] acetate |
|---|---|
| PubChem CID | 12988804 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]oct-6-en-3-yl] acetate |
| SMILES | CC(=O)OC1C[C@H]2C=C[C@@H](C1)N2C |
| InChI | InChI=1S/C10H15NO2/c1-7(12)13-10-5-8-3-4-9(6-10)11(8)2/h3-4,8-10H,5-6H2,1-2H3/t8-,9+,10? |
| InChIKey | XVCJZEFEPLMMNK-ULKQDVFKSA-N |
| XLogP | 0.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|