C12H15NS — CID 12988965
4-(3-methylsulfanylphenyl)-1,2,3,6-tetrahydropyridine (PubChem CID 12988965) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 4-(3-methylsulfanylphenyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(3-methylsulfanylphenyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 12988965 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4-(3-methylsulfanylphenyl)-1,2,3,6-tetrahydropyridine |
| SMILES | CSc1cccc(C2=CCNCC2)c1 |
| InChI | InChI=1S/C12H15NS/c1-14-12-4-2-3-11(9-12)10-5-7-13-8-6-10/h2-5,9,13H,6-8H2,1H3 |
| InChIKey | SNWOGYXQQFQOME-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |