About 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate
6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate (PubChem CID 12989015) has the molecular formula C13H24O6
and a molecular weight of 276.33 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate.
Analyze 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate?
The IUPAC name of 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate (CID 12989015) is 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate.
What is the SMILES notation for 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate?
The canonical SMILES for 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate is CC(C)OC(=O)[C@@H](O)C[C@H](O)CC(=O)OC(C)(C)C.
What is the InChIKey of 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate?
The InChIKey is VLEAWGGMEJKHPY-UWVGGRQHSA-N. The full InChI is InChI=1S/C13H24O6/c1-8(2)18-12(17)10(15)6-9(14)7-11(16)19-13(3,4)5/h8-10,14-15H,6-7H2,1-5H3/t9-,10-/m0/s1.
What are the key properties of 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate?
6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate has a molecular weight of 276.33 g/mol, XLogP of 0.78, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-tert-butyl 1-O-propan-2-yl (2S,4S)-2,4-dihydroxyhexanedioate is sourced from PubChem (CID 12989015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).