C21H30O3 — CID 12989800
[(1R,2R,5S,10R,12R)-1-methoxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-6,8,13-trien-13-yl]methanol (PubChem CID 12989800) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is [(1R,2R,5S,10R,12R)-1-methoxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-6,8,13-trien-13-yl]methanol.
| Compound Name | [(1R,2R,5S,10R,12R)-1-methoxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-6,8,13-trien-13-yl]methanol |
|---|---|
| PubChem CID | 12989800 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(1R,2R,5S,10R,12R)-1-methoxy-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadeca-6,8,13-trien-13-yl]methanol |
| SMILES | CO[C@@]12C=C(CO)[C@@H](C[C@@H]3C4=C(C(C)C)C=C[C@]4(C)CC[C@]31C)O2 |
| InChI | InChI=1S/C21H30O3/c1-13(2)15-6-7-19(3)8-9-20(4)16(18(15)19)10-17-14(12-22)11-21(20,23-5)24-17/h6-7,11,13,16-17,22H,8-10,12H2,1-5H3/t16-,17-,19-,20-,21-/m1/s1 |
| InChIKey | DCBQWTJADDKIIR-XGAGZNTDSA-N |
| XLogP | 4.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|