C20H16N3O3+ — CID 12990344
methyl 5-cyano-6-oxo-4-phenyl-2-(pyridin-1-ium-1-ylmethyl)-1H-pyridine-3-carboxylate (PubChem CID 12990344) has the molecular formula C20H16N3O3+ and a molecular weight of 346.37 g/mol. Its IUPAC name is methyl 5-cyano-6-oxo-4-phenyl-2-(pyridin-1-ium-1-ylmethyl)-1H-pyridine-3-carboxylate.
| Compound Name | methyl 5-cyano-6-oxo-4-phenyl-2-(pyridin-1-ium-1-ylmethyl)-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 12990344 |
| Molecular Formula | C20H16N3O3+ |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | methyl 5-cyano-6-oxo-4-phenyl-2-(pyridin-1-ium-1-ylmethyl)-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C[n+]2ccccc2)[nH]c(=O)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C20H15N3O3/c1-26-20(25)18-16(13-23-10-6-3-7-11-23)22-19(24)15(12-21)17(18)14-8-4-2-5-9-14/h2-11H,13H2,1H3/p+1 |
| InChIKey | AVFJFJNQFUQJAP-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 86.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|