C10H30S3Si6 — CID 12990384
1,2,2,4,4,5,6,6,8,8-decamethyl-3,7,9-trithia-1,2,4,5,6,8-hexasilabicyclo[3.3.1]nonane (PubChem CID 12990384) has the molecular formula C10H30S3Si6 and a molecular weight of 415.07 g/mol. Its IUPAC name is 1,2,2,4,4,5,6,6,8,8-decamethyl-3,7,9-trithia-1,2,4,5,6,8-hexasilabicyclo[3.3.1]nonane.
| Compound Name | 1,2,2,4,4,5,6,6,8,8-decamethyl-3,7,9-trithia-1,2,4,5,6,8-hexasilabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 12990384 |
| Molecular Formula | C10H30S3Si6 |
| Molecular Weight | 415.07 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 1,2,2,4,4,5,6,6,8,8-decamethyl-3,7,9-trithia-1,2,4,5,6,8-hexasilabicyclo[3.3.1]nonane |
| SMILES | C[Si]1(C)S[Si](C)(C)[Si]2(C)S[Si]1(C)[Si](C)(C)S[Si]2(C)C |
| InChI | InChI=1S/C10H30S3Si6/c1-14(2)11-15(3,4)19(10)13-18(14,9)16(5,6)12-17(19,7)8/h1-10H3 |
| InChIKey | WPLITLWBRIQSQV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.07 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|