C17H12F4N2O — CID 1299057
2-[1-phenyl-3-(1,1,2,2-tetrafluoroethyl)pyrazol-5-yl]phenol (PubChem CID 1299057) has the molecular formula C17H12F4N2O and a molecular weight of 336.29 g/mol. Its IUPAC name is 2-[1-phenyl-3-(1,1,2,2-tetrafluoroethyl)pyrazol-5-yl]phenol.
| Compound Name | 2-[1-phenyl-3-(1,1,2,2-tetrafluoroethyl)pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 1299057 |
| Molecular Formula | C17H12F4N2O |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[1-phenyl-3-(1,1,2,2-tetrafluoroethyl)pyrazol-5-yl]phenol |
| SMILES | Oc1ccccc1-c1cc(C(F)(F)C(F)F)nn1-c1ccccc1 |
| InChI | InChI=1S/C17H12F4N2O/c18-16(19)17(20,21)15-10-13(12-8-4-5-9-14(12)24)23(22-15)11-6-2-1-3-7-11/h1-10,16,24H |
| InChIKey | SVVNXFBJVPDRDP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|