2-amino-5,5,5-trifluoro-3-methylpentanoic acid

C6H10F3NO2 — CID 12990634

IUPAC2-amino-5,5,5-trifluoro-3-methylpentanoic acid
SMILESCC(CC(F)(F)F)C(N)C(=O)O
InChIInChI=1S/C6H10F3NO2/c1-3(2-6(7,8)9)4(10)5(11)12/h3-4H,2,10H2,1H3,(H,11,12)
InChIKeyIISHLMOFSAYIEX-UHFFFAOYSA-N
MW185.14 g/mol
LogP0.99
Rot. Bonds3

About 2-amino-5,5,5-trifluoro-3-methylpentanoic acid

2-amino-5,5,5-trifluoro-3-methylpentanoic acid (PubChem CID 12990634) has the molecular formula C6H10F3NO2 and a molecular weight of 185.14 g/mol. Its IUPAC name is 2-amino-5,5,5-trifluoro-3-methylpentanoic acid.

Molecular Properties

Compound Name2-amino-5,5,5-trifluoro-3-methylpentanoic acid
PubChem CID12990634
Molecular FormulaC6H10F3NO2
Molecular Weight185.14 g/mol
Exact Mass185.07
IUPAC Name2-amino-5,5,5-trifluoro-3-methylpentanoic acid
SMILESCC(CC(F)(F)F)C(N)C(=O)O
InChIInChI=1S/C6H10F3NO2/c1-3(2-6(7,8)9)4(10)5(11)12/h3-4H,2,10H2,1H3,(H,11,12)
InChIKeyIISHLMOFSAYIEX-UHFFFAOYSA-N
XLogP0.99
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.14
LogP ≤ 50.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-amino-5,5,5-trifluoro-3-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5,5,5-trifluoro-3-methylpentanoic acid?
The IUPAC name of 2-amino-5,5,5-trifluoro-3-methylpentanoic acid (CID 12990634) is 2-amino-5,5,5-trifluoro-3-methylpentanoic acid.
What is the SMILES notation for 2-amino-5,5,5-trifluoro-3-methylpentanoic acid?
The canonical SMILES for 2-amino-5,5,5-trifluoro-3-methylpentanoic acid is CC(CC(F)(F)F)C(N)C(=O)O.
What is the InChIKey of 2-amino-5,5,5-trifluoro-3-methylpentanoic acid?
The InChIKey is IISHLMOFSAYIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3NO2/c1-3(2-6(7,8)9)4(10)5(11)12/h3-4H,2,10H2,1H3,(H,11,12).
What are the key properties of 2-amino-5,5,5-trifluoro-3-methylpentanoic acid?
2-amino-5,5,5-trifluoro-3-methylpentanoic acid has a molecular weight of 185.14 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,5,5-trifluoro-3-methylpentanoic acid is sourced from PubChem (CID 12990634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).