C20H38O2Si — CID 12990845
3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]but-3-en-1-ol (PubChem CID 12990845) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is 3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]but-3-en-1-ol.
| Compound Name | 3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 12990845 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 3-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]but-3-en-1-ol |
| SMILES | C=C(CCO)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C20H38O2Si/c1-15(12-14-21)16-10-11-17-18(9-8-13-20(16,17)5)22-23(6,7)19(2,3)4/h16-18,21H,1,8-14H2,2-7H3/t16-,17+,18+,20-/m1/s1 |
| InChIKey | VUKVAEDMVWKJJL-DOADOZAASA-N |
| XLogP | 5.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|