C27H27Cl3N4O4S — CID 12991425
6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrol-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 12991425) has the molecular formula C27H27Cl3N4O4S and a molecular weight of 609.96 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrol-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrol-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 12991425 |
| Molecular Formula | C27H27Cl3N4O4S |
| Molecular Weight | 609.96 g/mol |
| Exact Mass | 608.08 |
| IUPAC Name | 6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-propan-2-yl-3-pyrrol-1-yl-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | CC(C)N1CC2N(C(=O)C(n3cccc3)CN2S(=O)(=O)c2ccc(Cl)cc2Cl)C(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C27H27Cl3N4O4S/c1-17(2)32-16-25-33(39(37,38)24-10-9-20(29)14-21(24)30)15-23(31-11-3-4-12-31)27(36)34(25)22(26(32)35)13-18-5-7-19(28)8-6-18/h3-12,14,17,22-23,25H,13,15-16H2,1-2H3 |
| InChIKey | CBRSRFNDLOUKHP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.96 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |