About 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine
5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine (PubChem CID 12991484) has the molecular formula C14H10F3N5O2S
and a molecular weight of 369.33 g/mol. Its IUPAC name is 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine.
Molecular Properties
| Compound Name | 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine |
| PubChem CID | 12991484 |
| Molecular Formula | C14H10F3N5O2S |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine |
| SMILES | CS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)nc2-c2cccnc2)nc1 |
| InChI | InChI=1S/C14H10F3N5O2S/c1-25(23,24)10-4-5-11(19-8-10)22-12(9-3-2-6-18-7-9)20-13(21-22)14(15,16)17/h2-8H,1H3 |
| InChIKey | JLDAVRBNKFNZGA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine?
The IUPAC name of 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine (CID 12991484) is 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine.
What is the SMILES notation for 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine?
The canonical SMILES for 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine is CS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)nc2-c2cccnc2)nc1.
What is the InChIKey of 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine?
The InChIKey is JLDAVRBNKFNZGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N5O2S/c1-25(23,24)10-4-5-11(19-8-10)22-12(9-3-2-6-18-7-9)20-13(21-22)14(15,16)17/h2-8H,1H3.
What are the key properties of 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine?
5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine has a molecular weight of 369.33 g/mol, XLogP of 2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfonyl-2-[5-pyridin-3-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]pyridine is sourced from PubChem (CID 12991484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).