C22H42O4Si — CID 12991844
(4E,6E,8R,9S,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-8,10-dimethyldodeca-4,6-dienal (PubChem CID 12991844) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is (4E,6E,8R,9S,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-8,10-dimethyldodeca-4,6-dienal.
| Compound Name | (4E,6E,8R,9S,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-8,10-dimethyldodeca-4,6-dienal |
|---|---|
| PubChem CID | 12991844 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (4E,6E,8R,9S,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-8,10-dimethyldodeca-4,6-dienal |
| SMILES | COCO[C@H]([C@H](C)[C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/C=C/CCC=O |
| InChI | InChI=1S/C22H42O4Si/c1-18(15-13-11-10-12-14-16-23)21(25-17-24-7)19(2)20(3)26-27(8,9)22(4,5)6/h10-11,13,15-16,18-21H,12,14,17H2,1-9H3/b11-10+,15-13+/t18-,19-,20-,21+/m1/s1 |
| InChIKey | RTKZEOLLAIVBBF-QFGUCLKZSA-N |
| XLogP | 5.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|