C22H33BrO5S — CID 12991901
[(1R,2R,3S)-2-(bromomethyl)-2,3-dimethyl-3-(oxan-2-yloxymethyl)cyclopentyl]methyl 4-methylbenzenesulfonate (PubChem CID 12991901) has the molecular formula C22H33BrO5S and a molecular weight of 489.47 g/mol. Its IUPAC name is [(1R,2R,3S)-2-(bromomethyl)-2,3-dimethyl-3-(oxan-2-yloxymethyl)cyclopentyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,3S)-2-(bromomethyl)-2,3-dimethyl-3-(oxan-2-yloxymethyl)cyclopentyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 12991901 |
| Molecular Formula | C22H33BrO5S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [(1R,2R,3S)-2-(bromomethyl)-2,3-dimethyl-3-(oxan-2-yloxymethyl)cyclopentyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CC[C@](C)(COC3CCCCO3)[C@]2(C)CBr)cc1 |
| InChI | InChI=1S/C22H33BrO5S/c1-17-7-9-19(10-8-17)29(24,25)28-14-18-11-12-21(2,22(18,3)15-23)16-27-20-6-4-5-13-26-20/h7-10,18,20H,4-6,11-16H2,1-3H3/t18-,20?,21+,22+/m0/s1 |
| InChIKey | AQXLNHUOFGUSQA-GREFHBQXSA-N |
| XLogP | 5.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|