C30H31NO4 — CID 12991922
[5-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate (PubChem CID 12991922) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is [5-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [5-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 12991922 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | [5-[(4S,5S)-4,5-diphenyl-4,5-dihydro-1,2-oxazol-3-yl]-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C1=NO[C@H](c3ccccc3)[C@H]1c1ccccc1)CCC(C)(C)O2 |
| InChI | InChI=1S/C30H31NO4/c1-18-19(2)28(33-20(3)32)25(23-16-17-30(4,5)34-27(18)23)26-24(21-12-8-6-9-13-21)29(35-31-26)22-14-10-7-11-15-22/h6-15,24,29H,16-17H2,1-5H3/t24-,29+/m0/s1 |
| InChIKey | HEPHFXMIHFXODN-PWUYWRBVSA-N |
| XLogP | 6.59 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|