C9H8O3 — CID 12992053
(1S,2S,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,10-dione (PubChem CID 12992053) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is (1S,2S,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,10-dione.
| Compound Name | (1S,2S,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,10-dione |
|---|---|
| PubChem CID | 12992053 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | (1S,2S,6S,7R)-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,10-dione |
| SMILES | O=C1OC[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C1=O |
| InChI | InChI=1S/C9H8O3/c10-8-4-1-2-5(8)7-6(4)3-12-9(7)11/h1-2,4-7H,3H2/t4-,5+,6+,7-/m1/s1 |
| InChIKey | BOCDRMNGIYNUNK-JRTVQGFMSA-N |
| XLogP | 0.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|