About [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane
[(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane (PubChem CID 12992255) has the molecular formula C15H22Si
and a molecular weight of 230.43 g/mol. Its IUPAC name is [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane.
Molecular Properties
| Compound Name | [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane |
| PubChem CID | 12992255 |
| Molecular Formula | C15H22Si |
| Molecular Weight | 230.43 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane |
| SMILES | C=CCC/C=C\C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H22Si/c1-4-5-6-7-11-14-16(2,3)15-12-9-8-10-13-15/h4,7-13H,1,5-6,14H2,2-3H3/b11-7- |
| InChIKey | FURBMXPQPWSGEC-XFFZJAGNSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane?
The IUPAC name of [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane (CID 12992255) is [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane.
What is the SMILES notation for [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane?
The canonical SMILES for [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane is C=CCC/C=C\C[Si](C)(C)c1ccccc1.
What is the InChIKey of [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane?
The InChIKey is FURBMXPQPWSGEC-XFFZJAGNSA-N. The full InChI is InChI=1S/C15H22Si/c1-4-5-6-7-11-14-16(2,3)15-12-9-8-10-13-15/h4,7-13H,1,5-6,14H2,2-3H3/b11-7-.
What are the key properties of [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane?
[(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane has a molecular weight of 230.43 g/mol, XLogP of 4.12, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-hepta-2,6-dienyl]-dimethyl-phenylsilane is sourced from PubChem (CID 12992255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).