C21H29NO3 — CID 12992429
(8R,9S,10R,13S,14S,17R)-17-hydroxy-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-carbonitrile (PubChem CID 12992429) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17R)-17-hydroxy-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-carbonitrile.
| Compound Name | (8R,9S,10R,13S,14S,17R)-17-hydroxy-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-carbonitrile |
|---|---|
| PubChem CID | 12992429 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-hydroxy-13-methylspiro[1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-carbonitrile |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC5(CC[C@@H]43)OCCO5)[C@@H]1CC[C@]2(O)C#N |
| InChI | InChI=1S/C21H29NO3/c1-19-7-4-16-15-5-9-21(24-10-11-25-21)12-14(15)2-3-17(16)18(19)6-8-20(19,23)13-22/h12,15-18,23H,2-11H2,1H3/t15-,16+,17+,18-,19-,20-/m0/s1 |
| InChIKey | GTNMPELTKLRAHL-XGXHKTLJSA-N |
| XLogP | 3.56 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|