C33H35ClN4O3 — CID 12992627
1-[4-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]but-3-ynyl]-1-hydroxyurea (PubChem CID 12992627) has the molecular formula C33H35ClN4O3 and a molecular weight of 571.12 g/mol. Its IUPAC name is 1-[4-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]but-3-ynyl]-1-hydroxyurea.
| Compound Name | 1-[4-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]but-3-ynyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 12992627 |
| Molecular Formula | C33H35ClN4O3 |
| Molecular Weight | 571.12 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 1-[4-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]but-3-ynyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)CCC#Cc1ccc(OCCCN2CCC(=C3c4ccc(Cl)cc4CCc4cccnc43)CC2)cc1 |
| InChI | InChI=1S/C33H35ClN4O3/c34-28-11-14-30-27(23-28)10-9-26-6-3-17-36-32(26)31(30)25-15-20-37(21-16-25)18-4-22-41-29-12-7-24(8-13-29)5-1-2-19-38(40)33(35)39/h3,6-8,11-14,17,23,40H,2,4,9-10,15-16,18-22H2,(H2,35,39) |
| InChIKey | WLCVFIFUKJWBRL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.12 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|