C34H37ClN4O3 — CID 12992629
1-[4-[4-[4-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]butoxy]phenyl]but-3-ynyl]-1-hydroxyurea (PubChem CID 12992629) has the molecular formula C34H37ClN4O3 and a molecular weight of 585.15 g/mol. Its IUPAC name is 1-[4-[4-[4-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]butoxy]phenyl]but-3-ynyl]-1-hydroxyurea.
| Compound Name | 1-[4-[4-[4-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]butoxy]phenyl]but-3-ynyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 12992629 |
| Molecular Formula | C34H37ClN4O3 |
| Molecular Weight | 585.15 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | 1-[4-[4-[4-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]butoxy]phenyl]but-3-ynyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)CCC#Cc1ccc(OCCCCN2CCC(=C3c4ccc(Cl)cc4CCc4cccnc43)CC2)cc1 |
| InChI | InChI=1S/C34H37ClN4O3/c35-29-12-15-31-28(24-29)11-10-27-7-5-18-37-33(27)32(31)26-16-21-38(22-17-26)19-3-4-23-42-30-13-8-25(9-14-30)6-1-2-20-39(41)34(36)40/h5,7-9,12-15,18,24,41H,2-4,10-11,16-17,19-23H2,(H2,36,40) |
| InChIKey | GUUFVYCRQBZPLO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.15 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|