About [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate
[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate (PubChem CID 12992848) has the molecular formula C14H12F3NO4S
and a molecular weight of 347.31 g/mol. Its IUPAC name is [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate |
| PubChem CID | 12992848 |
| Molecular Formula | C14H12F3NO4S |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1coc(/C=C/c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C14H12F3NO4S/c1-23(19,20)22-9-12-8-21-13(18-12)7-4-10-2-5-11(6-3-10)14(15,16)17/h2-8H,9H2,1H3/b7-4+ |
| InChIKey | PEVZEMHKEZZHLS-QPJJXVBHSA-N |
| XLogP | 3.34 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate?
The IUPAC name of [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate (CID 12992848) is [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate.
What is the SMILES notation for [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate?
The canonical SMILES for [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate is CS(=O)(=O)OCc1coc(/C=C/c2ccc(C(F)(F)F)cc2)n1.
What is the InChIKey of [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate?
The InChIKey is PEVZEMHKEZZHLS-QPJJXVBHSA-N. The full InChI is InChI=1S/C14H12F3NO4S/c1-23(19,20)22-9-12-8-21-13(18-12)7-4-10-2-5-11(6-3-10)14(15,16)17/h2-8H,9H2,1H3/b7-4+.
What are the key properties of [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate?
[2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate has a molecular weight of 347.31 g/mol, XLogP of 3.34, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl methanesulfonate is sourced from PubChem (CID 12992848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).